C24H26N2O4 — CID 174746694
3-benzyl-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-4-phenylbutanoic acid (PubChem CID 174746694) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-benzyl-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-4-phenylbutanoic acid.
| Compound Name | 3-benzyl-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 174746694 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-benzyl-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-4-phenylbutanoic acid |
| SMILES | COC(Cc1ccccc1)(Cc1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)O |
| InChI | InChI=1S/C24H26N2O4/c1-17-14-18(2)26-23(25-17)30-21(22(27)28)24(29-3,15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20/h4-14,21H,15-16H2,1-3H3,(H,27,28) |
| InChIKey | BRCBISKPBMZYNK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |