About 2-bromopropyl(triphenyl)phosphanium;hydrobromide
2-bromopropyl(triphenyl)phosphanium;hydrobromide (PubChem CID 174746929) has the molecular formula C21H22Br2P+
and a molecular weight of 465.19 g/mol. Its IUPAC name is 2-bromopropyl(triphenyl)phosphanium;hydrobromide.
Molecular Properties
| Compound Name | 2-bromopropyl(triphenyl)phosphanium;hydrobromide |
| PubChem CID | 174746929 |
| Molecular Formula | C21H22Br2P+ |
| Molecular Weight | 465.19 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | 2-bromopropyl(triphenyl)phosphanium;hydrobromide |
| SMILES | Br.CC(Br)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21BrP.BrH/c1-18(22)17-23(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16,18H,17H2,1H3;1H/q+1; |
| InChIKey | CLOLNJJHKFWBQE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropyl(triphenyl)phosphanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropyl(triphenyl)phosphanium;hydrobromide?
The IUPAC name of 2-bromopropyl(triphenyl)phosphanium;hydrobromide (CID 174746929) is 2-bromopropyl(triphenyl)phosphanium;hydrobromide.
What is the SMILES notation for 2-bromopropyl(triphenyl)phosphanium;hydrobromide?
The canonical SMILES for 2-bromopropyl(triphenyl)phosphanium;hydrobromide is Br.CC(Br)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-bromopropyl(triphenyl)phosphanium;hydrobromide?
The InChIKey is CLOLNJJHKFWBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BrP.BrH/c1-18(22)17-23(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16,18H,17H2,1H3;1H/q+1;.
What are the key properties of 2-bromopropyl(triphenyl)phosphanium;hydrobromide?
2-bromopropyl(triphenyl)phosphanium;hydrobromide has a molecular weight of 465.19 g/mol, XLogP of 5.34, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropyl(triphenyl)phosphanium;hydrobromide is sourced from PubChem (CID 174746929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).