About azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole
azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole (PubChem CID 174747019) has the molecular formula C11H14N6OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole |
| PubChem CID | 174747019 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole |
| SMILES | CCCOc1nnnn1-c1nc2ccccc2s1.N |
| InChI | InChI=1S/C11H11N5OS.H3N/c1-2-7-17-10-13-14-15-16(10)11-12-8-5-3-4-6-9(8)18-11;/h3-6H,2,7H2,1H3;1H3 |
| InChIKey | UTWPMHFYRVYBIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole?
The IUPAC name of azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole (CID 174747019) is azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole.
What is the SMILES notation for azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole?
The canonical SMILES for azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole is CCCOc1nnnn1-c1nc2ccccc2s1.N.
What is the InChIKey of azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole?
The InChIKey is UTWPMHFYRVYBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5OS.H3N/c1-2-7-17-10-13-14-15-16(10)11-12-8-5-3-4-6-9(8)18-11;/h3-6H,2,7H2,1H3;1H3.
What are the key properties of azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole?
azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole has a molecular weight of 278.34 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(5-propoxytetrazol-1-yl)-1,3-benzothiazole is sourced from PubChem (CID 174747019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).