About 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine
3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine (PubChem CID 174747123) has the molecular formula C12H10N4S
and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine.
Molecular Properties
| Compound Name | 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine |
| PubChem CID | 174747123 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine |
| SMILES | Nc1cnc(-c2nccs2)n1-c1ccccc1 |
| InChI | InChI=1S/C12H10N4S/c13-10-8-15-11(12-14-6-7-17-12)16(10)9-4-2-1-3-5-9/h1-8H,13H2 |
| InChIKey | PZZKMKYQKQFALY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine?
The IUPAC name of 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine (CID 174747123) is 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine.
What is the SMILES notation for 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine?
The canonical SMILES for 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine is Nc1cnc(-c2nccs2)n1-c1ccccc1.
What is the InChIKey of 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine?
The InChIKey is PZZKMKYQKQFALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4S/c13-10-8-15-11(12-14-6-7-17-12)16(10)9-4-2-1-3-5-9/h1-8H,13H2.
What are the key properties of 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine?
3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine has a molecular weight of 242.31 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-(1,3-thiazol-2-yl)imidazol-4-amine is sourced from PubChem (CID 174747123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).