C16H15FO3 — CID 174747558
1-(2-fluoro-3-phenylphenyl)-2,2-dimethoxyethanone (PubChem CID 174747558) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-(2-fluoro-3-phenylphenyl)-2,2-dimethoxyethanone.
| Compound Name | 1-(2-fluoro-3-phenylphenyl)-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 174747558 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-fluoro-3-phenylphenyl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)c1cccc(-c2ccccc2)c1F |
| InChI | InChI=1S/C16H15FO3/c1-19-16(20-2)15(18)13-10-6-9-12(14(13)17)11-7-4-3-5-8-11/h3-10,16H,1-2H3 |
| InChIKey | JHOSUBVQGLHZND-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|