About CID 174747854
CID 174747854 (PubChem CID 174747854) has the molecular formula C8H12BO
and a molecular weight of 134.99 g/mol.
Molecular Properties
| Compound Name | CID 174747854 |
| PubChem CID | 174747854 |
| Molecular Formula | C8H12BO |
| Molecular Weight | 134.99 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C.O.[B] |
| InChI | InChI=1S/C8H10.B.H2O/c1-7-5-3-4-6-8(7)2;;/h3-6H,1-2H3;;1H2 |
| InChIKey | KJERZBNDELPPQI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.99 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174747854 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174747854?
The IUPAC name of CID 174747854 (CID 174747854) is not available.
What is the SMILES notation for CID 174747854?
The canonical SMILES for CID 174747854 is Cc1ccccc1C.O.[B].
What is the InChIKey of CID 174747854?
The InChIKey is KJERZBNDELPPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.B.H2O/c1-7-5-3-4-6-8(7)2;;/h3-6H,1-2H3;;1H2.
What are the key properties of CID 174747854?
CID 174747854 has a molecular weight of 134.99 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174747854 is sourced from PubChem (CID 174747854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).