About 5,5-diethoxy-1,3-oxathian-2-one
5,5-diethoxy-1,3-oxathian-2-one (PubChem CID 174747933) has the molecular formula C8H14O4S
and a molecular weight of 206.26 g/mol. Its IUPAC name is 5,5-diethoxy-1,3-oxathian-2-one.
Molecular Properties
| Compound Name | 5,5-diethoxy-1,3-oxathian-2-one |
| PubChem CID | 174747933 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5,5-diethoxy-1,3-oxathian-2-one |
| SMILES | CCOC1(OCC)COC(=O)SC1 |
| InChI | InChI=1S/C8H14O4S/c1-3-11-8(12-4-2)5-10-7(9)13-6-8/h3-6H2,1-2H3 |
| InChIKey | CXXVAJQICRYPIT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diethoxy-1,3-oxathian-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethoxy-1,3-oxathian-2-one?
The IUPAC name of 5,5-diethoxy-1,3-oxathian-2-one (CID 174747933) is 5,5-diethoxy-1,3-oxathian-2-one.
What is the SMILES notation for 5,5-diethoxy-1,3-oxathian-2-one?
The canonical SMILES for 5,5-diethoxy-1,3-oxathian-2-one is CCOC1(OCC)COC(=O)SC1.
What is the InChIKey of 5,5-diethoxy-1,3-oxathian-2-one?
The InChIKey is CXXVAJQICRYPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S/c1-3-11-8(12-4-2)5-10-7(9)13-6-8/h3-6H2,1-2H3.
What are the key properties of 5,5-diethoxy-1,3-oxathian-2-one?
5,5-diethoxy-1,3-oxathian-2-one has a molecular weight of 206.26 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethoxy-1,3-oxathian-2-one is sourced from PubChem (CID 174747933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).