C21H26N2O2 — CID 174748348
3-phenylbenzene-1,2-diamine;4-propylcyclohexa-2,4-diene-1,1-diol (PubChem CID 174748348) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-phenylbenzene-1,2-diamine;4-propylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 3-phenylbenzene-1,2-diamine;4-propylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 174748348 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-phenylbenzene-1,2-diamine;4-propylcyclohexa-2,4-diene-1,1-diol |
| SMILES | CCCC1=CCC(O)(O)C=C1.Nc1cccc(-c2ccccc2)c1N |
| InChI | InChI=1S/C12H12N2.C9H14O2/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-2-3-8-4-6-9(10,11)7-5-8/h1-8H,13-14H2;4-6,10-11H,2-3,7H2,1H3 |
| InChIKey | RHKKCZSHGINYIY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|