C12H19NO2Si — CID 174748674
4-(hydroxymethyl)-N-(trimethylsilylmethyl)benzamide (PubChem CID 174748674) has the molecular formula C12H19NO2Si and a molecular weight of 237.38 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-(trimethylsilylmethyl)benzamide.
| Compound Name | 4-(hydroxymethyl)-N-(trimethylsilylmethyl)benzamide |
|---|---|
| PubChem CID | 174748674 |
| Molecular Formula | C12H19NO2Si |
| Molecular Weight | 237.38 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-(hydroxymethyl)-N-(trimethylsilylmethyl)benzamide |
| SMILES | C[Si](C)(C)CNC(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C12H19NO2Si/c1-16(2,3)9-13-12(15)11-6-4-10(8-14)5-7-11/h4-7,14H,8-9H2,1-3H3,(H,13,15) |
| InChIKey | NNIRNOSQWDMPOS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|