C13H28O3Si2 — CID 174749191
methyl 2-methylprop-2-enoate;2,2,3,3,6-pentamethyloxadisilinane (PubChem CID 174749191) has the molecular formula C13H28O3Si2 and a molecular weight of 288.54 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2,2,3,3,6-pentamethyloxadisilinane.
| Compound Name | methyl 2-methylprop-2-enoate;2,2,3,3,6-pentamethyloxadisilinane |
|---|---|
| PubChem CID | 174749191 |
| Molecular Formula | C13H28O3Si2 |
| Molecular Weight | 288.54 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2,2,3,3,6-pentamethyloxadisilinane |
| SMILES | C=C(C)C(=O)OC.CC1CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C8H20OSi2.C5H8O2/c1-8-6-7-10(2,3)11(4,5)9-8;1-4(2)5(6)7-3/h8H,6-7H2,1-5H3;1H2,2-3H3 |
| InChIKey | VJSXNKBEHLUECU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|