About 1-butylpiperidine;1,2-dihydrotetrazole-5-thione
1-butylpiperidine;1,2-dihydrotetrazole-5-thione (PubChem CID 174749959) has the molecular formula C10H21N5S
and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-butylpiperidine;1,2-dihydrotetrazole-5-thione.
Molecular Properties
| Compound Name | 1-butylpiperidine;1,2-dihydrotetrazole-5-thione |
| PubChem CID | 174749959 |
| Molecular Formula | C10H21N5S |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-butylpiperidine;1,2-dihydrotetrazole-5-thione |
| SMILES | CCCCN1CCCCC1.S=c1nn[nH][nH]1 |
| InChI | InChI=1S/C9H19N.CH2N4S/c1-2-3-7-10-8-5-4-6-9-10;6-1-2-4-5-3-1/h2-9H2,1H3;(H2,2,3,4,5,6) |
| InChIKey | GVHDUYDGMVLQAR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpiperidine;1,2-dihydrotetrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpiperidine;1,2-dihydrotetrazole-5-thione?
The IUPAC name of 1-butylpiperidine;1,2-dihydrotetrazole-5-thione (CID 174749959) is 1-butylpiperidine;1,2-dihydrotetrazole-5-thione.
What is the SMILES notation for 1-butylpiperidine;1,2-dihydrotetrazole-5-thione?
The canonical SMILES for 1-butylpiperidine;1,2-dihydrotetrazole-5-thione is CCCCN1CCCCC1.S=c1nn[nH][nH]1.
What is the InChIKey of 1-butylpiperidine;1,2-dihydrotetrazole-5-thione?
The InChIKey is GVHDUYDGMVLQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.CH2N4S/c1-2-3-7-10-8-5-4-6-9-10;6-1-2-4-5-3-1/h2-9H2,1H3;(H2,2,3,4,5,6).
What are the key properties of 1-butylpiperidine;1,2-dihydrotetrazole-5-thione?
1-butylpiperidine;1,2-dihydrotetrazole-5-thione has a molecular weight of 243.38 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpiperidine;1,2-dihydrotetrazole-5-thione is sourced from PubChem (CID 174749959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).