C20H20N2 — CID 174750124
1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole (PubChem CID 174750124) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole.
| Compound Name | 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole |
|---|---|
| PubChem CID | 174750124 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole |
| SMILES | C=C(c1cc(C)cc(C)c1)c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C20H20N2/c1-15-9-16(2)11-19(10-15)17(3)20-13-22(14-21-20)12-18-7-5-4-6-8-18/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | MWRHPIXEQBQYFU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |