About 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole
1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole (PubChem CID 174750124) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole.
Molecular Properties
| Compound Name | 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole |
| PubChem CID | 174750124 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole |
| SMILES | C=C(c1cc(C)cc(C)c1)c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C20H20N2/c1-15-9-16(2)11-19(10-15)17(3)20-13-22(14-21-20)12-18-7-5-4-6-8-18/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | MWRHPIXEQBQYFU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole?
The IUPAC name of 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole (CID 174750124) is 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole.
What is the SMILES notation for 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole?
The canonical SMILES for 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole is C=C(c1cc(C)cc(C)c1)c1cn(Cc2ccccc2)cn1.
What is the InChIKey of 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole?
The InChIKey is MWRHPIXEQBQYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-15-9-16(2)11-19(10-15)17(3)20-13-22(14-21-20)12-18-7-5-4-6-8-18/h4-11,13-14H,3,12H2,1-2H3.
What are the key properties of 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole?
1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole has a molecular weight of 288.39 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[1-(3,5-dimethylphenyl)ethenyl]imidazole is sourced from PubChem (CID 174750124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).