C22H38N2O3Si — CID 174750677
N-(3-phenylprop-2-enyl)-N'-(1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,2-diamine (PubChem CID 174750677) has the molecular formula C22H38N2O3Si and a molecular weight of 406.64 g/mol. Its IUPAC name is N-(3-phenylprop-2-enyl)-N'-(1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,2-diamine.
| Compound Name | N-(3-phenylprop-2-enyl)-N'-(1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 174750677 |
| Molecular Formula | C22H38N2O3Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | N-(3-phenylprop-2-enyl)-N'-(1,1,2-trimethoxy-2-propylsilinan-3-yl)ethane-1,2-diamine |
| SMILES | CCCC1(OC)C(NCCNCC=Cc2ccccc2)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C22H38N2O3Si/c1-5-15-22(25-2)21(14-10-19-28(22,26-3)27-4)24-18-17-23-16-9-13-20-11-7-6-8-12-20/h6-9,11-13,21,23-24H,5,10,14-19H2,1-4H3 |
| InChIKey | XAEOPMQMCLRUPO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|