About cyclohexa-2,4-dien-1-one;methanesulfonohydrazide
cyclohexa-2,4-dien-1-one;methanesulfonohydrazide (PubChem CID 174750849) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-one;methanesulfonohydrazide.
Molecular Properties
| Compound Name | cyclohexa-2,4-dien-1-one;methanesulfonohydrazide |
| PubChem CID | 174750849 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | cyclohexa-2,4-dien-1-one;methanesulfonohydrazide |
| SMILES | CS(=O)(=O)NN.O=C1C=CC=CC1 |
| InChI | InChI=1S/C6H6O.CH6N2O2S/c7-6-4-2-1-3-5-6;1-6(4,5)3-2/h1-4H,5H2;3H,2H2,1H3 |
| InChIKey | UTEPKXHYWRDNDB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-dien-1-one;methanesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-dien-1-one;methanesulfonohydrazide?
The IUPAC name of cyclohexa-2,4-dien-1-one;methanesulfonohydrazide (CID 174750849) is cyclohexa-2,4-dien-1-one;methanesulfonohydrazide.
What is the SMILES notation for cyclohexa-2,4-dien-1-one;methanesulfonohydrazide?
The canonical SMILES for cyclohexa-2,4-dien-1-one;methanesulfonohydrazide is CS(=O)(=O)NN.O=C1C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-dien-1-one;methanesulfonohydrazide?
The InChIKey is UTEPKXHYWRDNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.CH6N2O2S/c7-6-4-2-1-3-5-6;1-6(4,5)3-2/h1-4H,5H2;3H,2H2,1H3.
What are the key properties of cyclohexa-2,4-dien-1-one;methanesulfonohydrazide?
cyclohexa-2,4-dien-1-one;methanesulfonohydrazide has a molecular weight of 204.25 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-dien-1-one;methanesulfonohydrazide is sourced from PubChem (CID 174750849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).