About sodium;hydride;2H-1,3-thiazole-3-carboxylic acid
sodium;hydride;2H-1,3-thiazole-3-carboxylic acid (PubChem CID 174751276) has the molecular formula C4H6NNaO2S
and a molecular weight of 155.15 g/mol. Its IUPAC name is sodium;hydride;2H-1,3-thiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | sodium;hydride;2H-1,3-thiazole-3-carboxylic acid |
| PubChem CID | 174751276 |
| Molecular Formula | C4H6NNaO2S |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | sodium;hydride;2H-1,3-thiazole-3-carboxylic acid |
| SMILES | O=C(O)N1C=CSC1.[H-].[Na+] |
| InChI | InChI=1S/C4H5NO2S.Na.H/c6-4(7)5-1-2-8-3-5;;/h1-2H,3H2,(H,6,7);;/q;+1;-1 |
| InChIKey | WDKHECHAYHZWNF-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;2H-1,3-thiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2H-1,3-thiazole-3-carboxylic acid?
The IUPAC name of sodium;hydride;2H-1,3-thiazole-3-carboxylic acid (CID 174751276) is sodium;hydride;2H-1,3-thiazole-3-carboxylic acid.
What is the SMILES notation for sodium;hydride;2H-1,3-thiazole-3-carboxylic acid?
The canonical SMILES for sodium;hydride;2H-1,3-thiazole-3-carboxylic acid is O=C(O)N1C=CSC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;2H-1,3-thiazole-3-carboxylic acid?
The InChIKey is WDKHECHAYHZWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S.Na.H/c6-4(7)5-1-2-8-3-5;;/h1-2H,3H2,(H,6,7);;/q;+1;-1.
What are the key properties of sodium;hydride;2H-1,3-thiazole-3-carboxylic acid?
sodium;hydride;2H-1,3-thiazole-3-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of -1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2H-1,3-thiazole-3-carboxylic acid is sourced from PubChem (CID 174751276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).