About 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide
1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide (PubChem CID 174751495) has the molecular formula C5H12BrNO4
and a molecular weight of 230.06 g/mol. Its IUPAC name is 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide.
Molecular Properties
| Compound Name | 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide |
| PubChem CID | 174751495 |
| Molecular Formula | C5H12BrNO4 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide |
| SMILES | Br.OC1CN(C(O)O)CC1O |
| InChI | InChI=1S/C5H11NO4.BrH/c7-3-1-6(5(9)10)2-4(3)8;/h3-5,7-10H,1-2H2;1H |
| InChIKey | RACYQZANIIYOEX-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide?
The IUPAC name of 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide (CID 174751495) is 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide.
What is the SMILES notation for 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide?
The canonical SMILES for 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide is Br.OC1CN(C(O)O)CC1O.
What is the InChIKey of 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide?
The InChIKey is RACYQZANIIYOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4.BrH/c7-3-1-6(5(9)10)2-4(3)8;/h3-5,7-10H,1-2H2;1H.
What are the key properties of 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide?
1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide has a molecular weight of 230.06 g/mol, XLogP of -2.13, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dihydroxymethyl)pyrrolidine-3,4-diol;hydrobromide is sourced from PubChem (CID 174751495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).