About N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide
N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide (PubChem CID 17475151) has the molecular formula C13H13IN4O
and a molecular weight of 368.18 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide.
Molecular Properties
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide |
| PubChem CID | 17475151 |
| Molecular Formula | C13H13IN4O |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2ccccc2I)n1 |
| InChI | InChI=1S/C13H13IN4O/c1-8-7-9(2)16-13(15-8)18-17-12(19)10-5-3-4-6-11(10)14/h3-7H,1-2H3,(H,17,19)(H,15,16,18) |
| InChIKey | PJOYNSCNJMNPFR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide?
The IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide (CID 17475151) is N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide.
What is the SMILES notation for N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide?
The canonical SMILES for N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide is Cc1cc(C)nc(NNC(=O)c2ccccc2I)n1.
What is the InChIKey of N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide?
The InChIKey is PJOYNSCNJMNPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IN4O/c1-8-7-9(2)16-13(15-8)18-17-12(19)10-5-3-4-6-11(10)14/h3-7H,1-2H3,(H,17,19)(H,15,16,18).
What are the key properties of N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide?
N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide has a molecular weight of 368.18 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,6-dimethylpyrimidin-2-yl)-2-iodobenzohydrazide is sourced from PubChem (CID 17475151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).