About 1,2-dimethylcyclohexane;isothiocyanic acid
1,2-dimethylcyclohexane;isothiocyanic acid (PubChem CID 174751826) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 1,2-dimethylcyclohexane;isothiocyanic acid.
Molecular Properties
| Compound Name | 1,2-dimethylcyclohexane;isothiocyanic acid |
| PubChem CID | 174751826 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 1,2-dimethylcyclohexane;isothiocyanic acid |
| SMILES | CC1CCCCC1C.N=C=S |
| InChI | InChI=1S/C8H16.CHNS/c1-7-5-3-4-6-8(7)2;2-1-3/h7-8H,3-6H2,1-2H3;2H |
| InChIKey | FGMVDYXAWRNXPX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylcyclohexane;isothiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylcyclohexane;isothiocyanic acid?
The IUPAC name of 1,2-dimethylcyclohexane;isothiocyanic acid (CID 174751826) is 1,2-dimethylcyclohexane;isothiocyanic acid.
What is the SMILES notation for 1,2-dimethylcyclohexane;isothiocyanic acid?
The canonical SMILES for 1,2-dimethylcyclohexane;isothiocyanic acid is CC1CCCCC1C.N=C=S.
What is the InChIKey of 1,2-dimethylcyclohexane;isothiocyanic acid?
The InChIKey is FGMVDYXAWRNXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.CHNS/c1-7-5-3-4-6-8(7)2;2-1-3/h7-8H,3-6H2,1-2H3;2H.
What are the key properties of 1,2-dimethylcyclohexane;isothiocyanic acid?
1,2-dimethylcyclohexane;isothiocyanic acid has a molecular weight of 171.31 g/mol, XLogP of 3.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylcyclohexane;isothiocyanic acid is sourced from PubChem (CID 174751826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).