About ethane;4-(4-hydroxyphenyl)phenol;propylbenzene
ethane;4-(4-hydroxyphenyl)phenol;propylbenzene (PubChem CID 174751919) has the molecular formula C23H28O2
and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;4-(4-hydroxyphenyl)phenol;propylbenzene.
Molecular Properties
| Compound Name | ethane;4-(4-hydroxyphenyl)phenol;propylbenzene |
| PubChem CID | 174751919 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethane;4-(4-hydroxyphenyl)phenol;propylbenzene |
| SMILES | CC.CCCc1ccccc1.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O2.C9H12.C2H6/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-6-9-7-4-3-5-8-9;1-2/h1-8,13-14H;3-5,7-8H,2,6H2,1H3;1-2H3 |
| InChIKey | KNDNBTNZTANEEJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(4-hydroxyphenyl)phenol;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-hydroxyphenyl)phenol;propylbenzene?
The IUPAC name of ethane;4-(4-hydroxyphenyl)phenol;propylbenzene (CID 174751919) is ethane;4-(4-hydroxyphenyl)phenol;propylbenzene.
What is the SMILES notation for ethane;4-(4-hydroxyphenyl)phenol;propylbenzene?
The canonical SMILES for ethane;4-(4-hydroxyphenyl)phenol;propylbenzene is CC.CCCc1ccccc1.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of ethane;4-(4-hydroxyphenyl)phenol;propylbenzene?
The InChIKey is KNDNBTNZTANEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C9H12.C2H6/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-6-9-7-4-3-5-8-9;1-2/h1-8,13-14H;3-5,7-8H,2,6H2,1H3;1-2H3.
What are the key properties of ethane;4-(4-hydroxyphenyl)phenol;propylbenzene?
ethane;4-(4-hydroxyphenyl)phenol;propylbenzene has a molecular weight of 336.48 g/mol, XLogP of 6.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-hydroxyphenyl)phenol;propylbenzene is sourced from PubChem (CID 174751919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).