About 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride
1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride (PubChem CID 174752292) has the molecular formula C15H33FOSi
and a molecular weight of 276.51 g/mol. Its IUPAC name is 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride.
Molecular Properties
| Compound Name | 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride |
| PubChem CID | 174752292 |
| Molecular Formula | C15H33FOSi |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride |
| SMILES | CCC1(OC(C)(C)C)CCCC[Si]1(CC)CC.F |
| InChI | InChI=1S/C15H32OSi.FH/c1-7-15(16-14(4,5)6)12-10-11-13-17(15,8-2)9-3;/h7-13H2,1-6H3;1H |
| InChIKey | SSRBPCINVLEMOK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride?
The IUPAC name of 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride (CID 174752292) is 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride.
What is the SMILES notation for 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride?
The canonical SMILES for 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride is CCC1(OC(C)(C)C)CCCC[Si]1(CC)CC.F.
What is the InChIKey of 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride?
The InChIKey is SSRBPCINVLEMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32OSi.FH/c1-7-15(16-14(4,5)6)12-10-11-13-17(15,8-2)9-3;/h7-13H2,1-6H3;1H.
What are the key properties of 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride?
1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride has a molecular weight of 276.51 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-triethyl-2-[(2-methylpropan-2-yl)oxy]silinane;hydrofluoride is sourced from PubChem (CID 174752292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).