About 2-iodo-1,3,4,5-tetramethyl-1H-indene
2-iodo-1,3,4,5-tetramethyl-1H-indene (PubChem CID 174753925) has the molecular formula C13H15I
and a molecular weight of 298.17 g/mol. Its IUPAC name is 2-iodo-1,3,4,5-tetramethyl-1H-indene.
Molecular Properties
| Compound Name | 2-iodo-1,3,4,5-tetramethyl-1H-indene |
| PubChem CID | 174753925 |
| Molecular Formula | C13H15I |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-iodo-1,3,4,5-tetramethyl-1H-indene |
| SMILES | CC1=C(I)C(C)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C13H15I/c1-7-5-6-11-9(3)13(14)10(4)12(11)8(7)2/h5-6,9H,1-4H3 |
| InChIKey | YXJNPRJSLRICIQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-1,3,4,5-tetramethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-1,3,4,5-tetramethyl-1H-indene?
The IUPAC name of 2-iodo-1,3,4,5-tetramethyl-1H-indene (CID 174753925) is 2-iodo-1,3,4,5-tetramethyl-1H-indene.
What is the SMILES notation for 2-iodo-1,3,4,5-tetramethyl-1H-indene?
The canonical SMILES for 2-iodo-1,3,4,5-tetramethyl-1H-indene is CC1=C(I)C(C)c2ccc(C)c(C)c21.
What is the InChIKey of 2-iodo-1,3,4,5-tetramethyl-1H-indene?
The InChIKey is YXJNPRJSLRICIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15I/c1-7-5-6-11-9(3)13(14)10(4)12(11)8(7)2/h5-6,9H,1-4H3.
What are the key properties of 2-iodo-1,3,4,5-tetramethyl-1H-indene?
2-iodo-1,3,4,5-tetramethyl-1H-indene has a molecular weight of 298.17 g/mol, XLogP of 4.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-1,3,4,5-tetramethyl-1H-indene is sourced from PubChem (CID 174753925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).