C33H64N4O2 — CID 174754010
N-[1-[4-[2,2-dimethylpropyl(formyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl]-2,2,6,6-tetramethylpiperidin-4-yl]-N-(2-ethylhexyl)formamide (PubChem CID 174754010) has the molecular formula C33H64N4O2 and a molecular weight of 548.90 g/mol. Its IUPAC name is N-[1-[4-[2,2-dimethylpropyl(formyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl]-2,2,6,6-tetramethylpiperidin-4-yl]-N-(2-ethylhexyl)formamide.
| Compound Name | N-[1-[4-[2,2-dimethylpropyl(formyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl]-2,2,6,6-tetramethylpiperidin-4-yl]-N-(2-ethylhexyl)formamide |
|---|---|
| PubChem CID | 174754010 |
| Molecular Formula | C33H64N4O2 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.50 |
| IUPAC Name | N-[1-[4-[2,2-dimethylpropyl(formyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl]-2,2,6,6-tetramethylpiperidin-4-yl]-N-(2-ethylhexyl)formamide |
| SMILES | CCCCC(CC)CN(C=O)C1CC(C)(C)N(N2C(C)(C)CC(N(C=O)CC(C)(C)C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C33H64N4O2/c1-14-16-17-26(15-2)22-34(24-38)27-18-30(6,7)36(31(8,9)19-27)37-32(10,11)20-28(21-33(37,12)13)35(25-39)23-29(3,4)5/h24-28H,14-23H2,1-13H3 |
| InChIKey | IUFWAXBDOUWXQH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|