C21H38O — CID 174755013
(1S,3R,4R,8S,11S,12R)-12-(methoxymethyl)-4,8,15,15-tetramethyltricyclo[9.3.1.03,8]pentadecane (PubChem CID 174755013) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (1S,3R,4R,8S,11S,12R)-12-(methoxymethyl)-4,8,15,15-tetramethyltricyclo[9.3.1.03,8]pentadecane.
| Compound Name | (1S,3R,4R,8S,11S,12R)-12-(methoxymethyl)-4,8,15,15-tetramethyltricyclo[9.3.1.03,8]pentadecane |
|---|---|
| PubChem CID | 174755013 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (1S,3R,4R,8S,11S,12R)-12-(methoxymethyl)-4,8,15,15-tetramethyltricyclo[9.3.1.03,8]pentadecane |
| SMILES | COC[C@@H]1CC[C@H]2C[C@@H]3[C@H](C)CCC[C@@]3(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H38O/c1-15-7-6-11-21(4)12-10-18-16(14-22-5)8-9-17(13-19(15)21)20(18,2)3/h15-19H,6-14H2,1-5H3/t15-,16+,17+,18+,19-,21+/m1/s1 |
| InChIKey | UHSBYYBKKCYRFQ-CJGWPVQMSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |