About 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene
1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 174755041) has the molecular formula C12H10Cl2
and a molecular weight of 225.12 g/mol. Its IUPAC name is 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene.
Molecular Properties
| Compound Name | 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene |
| PubChem CID | 174755041 |
| Molecular Formula | C12H10Cl2 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | Clc1ccc([C@@H]2C=CC=CC2)cc1Cl |
| InChI | InChI=1S/C12H10Cl2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-4,6-9H,5H2/t9-/m1/s1 |
| InChIKey | QGVKGXLHRHPJJQ-SECBINFHSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene?
The IUPAC name of 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene (CID 174755041) is 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene.
What is the SMILES notation for 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene?
The canonical SMILES for 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene is Clc1ccc([C@@H]2C=CC=CC2)cc1Cl.
What is the InChIKey of 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene?
The InChIKey is QGVKGXLHRHPJJQ-SECBINFHSA-N. The full InChI is InChI=1S/C12H10Cl2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-4,6-9H,5H2/t9-/m1/s1.
What are the key properties of 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene?
1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene has a molecular weight of 225.12 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-[(1S)-cyclohexa-2,4-dien-1-yl]benzene is sourced from PubChem (CID 174755041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).