About CID 174755667
CID 174755667 (PubChem CID 174755667) has the molecular formula C12H16OSi
and a molecular weight of 204.34 g/mol.
Molecular Properties
| Compound Name | CID 174755667 |
| PubChem CID | 174755667 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | — |
| SMILES | C=CCC[Si]c1ccccc1COC |
| InChI | InChI=1S/C12H16OSi/c1-3-4-9-14-12-8-6-5-7-11(12)10-13-2/h3,5-8H,1,4,9-10H2,2H3 |
| InChIKey | XERACKLUKPUISI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 174755667 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174755667?
The IUPAC name of CID 174755667 (CID 174755667) is not available.
What is the SMILES notation for CID 174755667?
The canonical SMILES for CID 174755667 is C=CCC[Si]c1ccccc1COC.
What is the InChIKey of CID 174755667?
The InChIKey is XERACKLUKPUISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OSi/c1-3-4-9-14-12-8-6-5-7-11(12)10-13-2/h3,5-8H,1,4,9-10H2,2H3.
What are the key properties of CID 174755667?
CID 174755667 has a molecular weight of 204.34 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174755667 is sourced from PubChem (CID 174755667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).