C51H32F4N6O3 — CID 174755822
bis[4-(2,6-difluoro-3-phenylmethoxyphenyl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 174755822) has the molecular formula C51H32F4N6O3 and a molecular weight of 852.85 g/mol. Its IUPAC name is bis[4-(2,6-difluoro-3-phenylmethoxyphenyl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | bis[4-(2,6-difluoro-3-phenylmethoxyphenyl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 174755822 |
| Molecular Formula | C51H32F4N6O3 |
| Molecular Weight | 852.85 g/mol |
| Exact Mass | 852.25 |
| IUPAC Name | bis[4-(2,6-difluoro-3-phenylmethoxyphenyl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | O=C(c1c[nH]c2ncc(-c3cccnc3)c(-c3c(F)ccc(OCc4ccccc4)c3F)c12)c1c[nH]c2ncc(-c3cccnc3)c(-c3c(F)ccc(OCc4ccccc4)c3F)c12 |
| InChI | InChI=1S/C51H32F4N6O3/c52-37-15-17-39(63-27-29-9-3-1-4-10-29)47(54)45(37)41-33(31-13-7-19-56-21-31)23-58-50-43(41)35(25-60-50)49(62)36-26-61-51-44(36)42(34(24-59-51)32-14-8-20-57-22-32)46-38(53)16-18-40(48(46)55)64-28-30-11-5-2-6-12-30/h1-26H,27-28H2,(H,58,60)(H,59,61) |
| InChIKey | NBTDIKYBKAHGSF-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.85 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |