About [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate
[2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate (PubChem CID 174755837) has the molecular formula C9H11NO5S
and a molecular weight of 245.26 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate |
| PubChem CID | 174755837 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OC(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO5S/c11-6-1-2-7(12)10(6)5-9(14)15-8(13)3-4-16/h16H,1-5H2 |
| InChIKey | CACWKMHNZAXRJQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate?
The IUPAC name of [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate (CID 174755837) is [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate.
What is the SMILES notation for [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate?
The canonical SMILES for [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate is O=C(CCS)OC(=O)CN1C(=O)CCC1=O.
What is the InChIKey of [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate?
The InChIKey is CACWKMHNZAXRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S/c11-6-1-2-7(12)10(6)5-9(14)15-8(13)3-4-16/h16H,1-5H2.
What are the key properties of [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate?
[2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate has a molecular weight of 245.26 g/mol, XLogP of -0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dioxopyrrolidin-1-yl)acetyl] 3-sulfanylpropanoate is sourced from PubChem (CID 174755837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).