About 1,4-dichlorobenzene;trichloroalumane
1,4-dichlorobenzene;trichloroalumane (PubChem CID 174756083) has the molecular formula C6H4AlCl5
and a molecular weight of 280.35 g/mol. Its IUPAC name is 1,4-dichlorobenzene;trichloroalumane.
Molecular Properties
| Compound Name | 1,4-dichlorobenzene;trichloroalumane |
| PubChem CID | 174756083 |
| Molecular Formula | C6H4AlCl5 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 277.86 |
| IUPAC Name | 1,4-dichlorobenzene;trichloroalumane |
| SMILES | Cl[Al](Cl)Cl.Clc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4Cl2.Al.3ClH/c7-5-1-2-6(8)4-3-5;;;;/h1-4H;;3*1H/q;+3;;;/p-3 |
| InChIKey | TXGIMOPTZDVJRU-UHFFFAOYSA-K |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dichlorobenzene;trichloroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichlorobenzene;trichloroalumane?
The IUPAC name of 1,4-dichlorobenzene;trichloroalumane (CID 174756083) is 1,4-dichlorobenzene;trichloroalumane.
What is the SMILES notation for 1,4-dichlorobenzene;trichloroalumane?
The canonical SMILES for 1,4-dichlorobenzene;trichloroalumane is Cl[Al](Cl)Cl.Clc1ccc(Cl)cc1.
What is the InChIKey of 1,4-dichlorobenzene;trichloroalumane?
The InChIKey is TXGIMOPTZDVJRU-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H4Cl2.Al.3ClH/c7-5-1-2-6(8)4-3-5;;;;/h1-4H;;3*1H/q;+3;;;/p-3.
What are the key properties of 1,4-dichlorobenzene;trichloroalumane?
1,4-dichlorobenzene;trichloroalumane has a molecular weight of 280.35 g/mol, XLogP of 4.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichlorobenzene;trichloroalumane is sourced from PubChem (CID 174756083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).