About 2-amino-4-methylpentanoic acid;1-chloropentane
2-amino-4-methylpentanoic acid;1-chloropentane (PubChem CID 174756116) has the molecular formula C11H24ClNO2
and a molecular weight of 237.77 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;1-chloropentane.
Molecular Properties
| Compound Name | 2-amino-4-methylpentanoic acid;1-chloropentane |
| PubChem CID | 174756116 |
| Molecular Formula | C11H24ClNO2 |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;1-chloropentane |
| SMILES | CC(C)CC(N)C(=O)O.CCCCCCl |
| InChI | InChI=1S/C6H13NO2.C5H11Cl/c1-4(2)3-5(7)6(8)9;1-2-3-4-5-6/h4-5H,3,7H2,1-2H3,(H,8,9);2-5H2,1H3 |
| InChIKey | SASWDUWIPYCULE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-methylpentanoic acid;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylpentanoic acid;1-chloropentane?
The IUPAC name of 2-amino-4-methylpentanoic acid;1-chloropentane (CID 174756116) is 2-amino-4-methylpentanoic acid;1-chloropentane.
What is the SMILES notation for 2-amino-4-methylpentanoic acid;1-chloropentane?
The canonical SMILES for 2-amino-4-methylpentanoic acid;1-chloropentane is CC(C)CC(N)C(=O)O.CCCCCCl.
What is the InChIKey of 2-amino-4-methylpentanoic acid;1-chloropentane?
The InChIKey is SASWDUWIPYCULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C5H11Cl/c1-4(2)3-5(7)6(8)9;1-2-3-4-5-6/h4-5H,3,7H2,1-2H3,(H,8,9);2-5H2,1H3.
What are the key properties of 2-amino-4-methylpentanoic acid;1-chloropentane?
2-amino-4-methylpentanoic acid;1-chloropentane has a molecular weight of 237.77 g/mol, XLogP of 2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylpentanoic acid;1-chloropentane is sourced from PubChem (CID 174756116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).