About (5-acetamido-1H-1,2,4-triazol-3-yl) acetate
(5-acetamido-1H-1,2,4-triazol-3-yl) acetate (PubChem CID 174756463) has the molecular formula C6H8N4O3
and a molecular weight of 184.16 g/mol. Its IUPAC name is (5-acetamido-1H-1,2,4-triazol-3-yl) acetate.
Molecular Properties
| Compound Name | (5-acetamido-1H-1,2,4-triazol-3-yl) acetate |
| PubChem CID | 174756463 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (5-acetamido-1H-1,2,4-triazol-3-yl) acetate |
| SMILES | CC(=O)Nc1nc(OC(C)=O)n[nH]1 |
| InChI | InChI=1S/C6H8N4O3/c1-3(11)7-5-8-6(10-9-5)13-4(2)12/h1-2H3,(H2,7,8,9,10,11) |
| InChIKey | DENAPZFYVOINHQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-acetamido-1H-1,2,4-triazol-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetamido-1H-1,2,4-triazol-3-yl) acetate?
The IUPAC name of (5-acetamido-1H-1,2,4-triazol-3-yl) acetate (CID 174756463) is (5-acetamido-1H-1,2,4-triazol-3-yl) acetate.
What is the SMILES notation for (5-acetamido-1H-1,2,4-triazol-3-yl) acetate?
The canonical SMILES for (5-acetamido-1H-1,2,4-triazol-3-yl) acetate is CC(=O)Nc1nc(OC(C)=O)n[nH]1.
What is the InChIKey of (5-acetamido-1H-1,2,4-triazol-3-yl) acetate?
The InChIKey is DENAPZFYVOINHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3/c1-3(11)7-5-8-6(10-9-5)13-4(2)12/h1-2H3,(H2,7,8,9,10,11).
What are the key properties of (5-acetamido-1H-1,2,4-triazol-3-yl) acetate?
(5-acetamido-1H-1,2,4-triazol-3-yl) acetate has a molecular weight of 184.16 g/mol, XLogP of -0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetamido-1H-1,2,4-triazol-3-yl) acetate is sourced from PubChem (CID 174756463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).