About 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+)
1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) (PubChem CID 174756791) has the molecular formula C6H11ClTi
and a molecular weight of 166.47 g/mol. Its IUPAC name is 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+).
Molecular Properties
| Compound Name | 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) |
| PubChem CID | 174756791 |
| Molecular Formula | C6H11ClTi |
| Molecular Weight | 166.47 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) |
| SMILES | CC1=C(Cl)CC=C1.[H-].[H-].[H-].[H-].[Ti+4] |
| InChI | InChI=1S/C6H7Cl.Ti.4H/c1-5-3-2-4-6(5)7;;;;;/h2-3H,4H2,1H3;;;;;/q;+4;4*-1 |
| InChIKey | PFLOFFOASAEWSN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+)?
The IUPAC name of 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) (CID 174756791) is 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+).
What is the SMILES notation for 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+)?
The canonical SMILES for 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) is CC1=C(Cl)CC=C1.[H-].[H-].[H-].[H-].[Ti+4].
What is the InChIKey of 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+)?
The InChIKey is PFLOFFOASAEWSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl.Ti.4H/c1-5-3-2-4-6(5)7;;;;;/h2-3H,4H2,1H3;;;;;/q;+4;4*-1.
What are the key properties of 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+)?
1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) has a molecular weight of 166.47 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methylcyclopenta-1,3-diene;hydride;titanium(4+) is sourced from PubChem (CID 174756791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).