About [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol
[(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol (PubChem CID 174758303) has the molecular formula C11H10ClN5O
and a molecular weight of 263.69 g/mol. Its IUPAC name is [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol |
| PubChem CID | 174758303 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol |
| SMILES | Nc1nc(Cl)c2ncn([C@H]3C=C=C(CO)C3)c2n1 |
| InChI | InChI=1S/C11H10ClN5O/c12-9-8-10(16-11(13)15-9)17(5-14-8)7-2-1-6(3-7)4-18/h2,5,7,18H,3-4H2,(H2,13,15,16)/t7-/m0/s1 |
| InChIKey | OCWAHGYNEBZREF-ZETCQYMHSA-N |
| XLogP | 1.08 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol?
The IUPAC name of [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol (CID 174758303) is [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol.
What is the SMILES notation for [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol?
The canonical SMILES for [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol is Nc1nc(Cl)c2ncn([C@H]3C=C=C(CO)C3)c2n1.
What is the InChIKey of [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol?
The InChIKey is OCWAHGYNEBZREF-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H10ClN5O/c12-9-8-10(16-11(13)15-9)17(5-14-8)7-2-1-6(3-7)4-18/h2,5,7,18H,3-4H2,(H2,13,15,16)/t7-/m0/s1.
What are the key properties of [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol?
[(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol has a molecular weight of 263.69 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-4-(2-amino-6-chloropurin-9-yl)cyclopenta-1,2-dien-1-yl]methanol is sourced from PubChem (CID 174758303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).