About prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate
prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate (PubChem CID 174758357) has the molecular formula C16H21NO6S
and a molecular weight of 355.41 g/mol. Its IUPAC name is prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate.
Molecular Properties
| Compound Name | prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate |
| PubChem CID | 174758357 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate |
| SMILES | C=CCOC(=O)c1ccc(C(C)(N)OS(=O)O)c(OCC2CC2)c1 |
| InChI | InChI=1S/C16H21NO6S/c1-3-8-21-15(18)12-6-7-13(16(2,17)23-24(19)20)14(9-12)22-10-11-4-5-11/h3,6-7,9,11H,1,4-5,8,10,17H2,2H3,(H,19,20) |
| InChIKey | LNVDZMAOOAKJQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate?
The IUPAC name of prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate (CID 174758357) is prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate.
What is the SMILES notation for prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate?
The canonical SMILES for prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate is C=CCOC(=O)c1ccc(C(C)(N)OS(=O)O)c(OCC2CC2)c1.
What is the InChIKey of prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate?
The InChIKey is LNVDZMAOOAKJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO6S/c1-3-8-21-15(18)12-6-7-13(16(2,17)23-24(19)20)14(9-12)22-10-11-4-5-11/h3,6-7,9,11H,1,4-5,8,10,17H2,2H3,(H,19,20).
What are the key properties of prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate?
prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate has a molecular weight of 355.41 g/mol, XLogP of 2.10, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 4-(1-amino-1-sulfinooxyethyl)-3-(cyclopropylmethoxy)benzoate is sourced from PubChem (CID 174758357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).