C19H13ClN4O4 — CID 17475946
N'-(4-chlorobenzoyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 17475946) has the molecular formula C19H13ClN4O4 and a molecular weight of 396.79 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 17475946 |
| Molecular Formula | C19H13ClN4O4 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N'-(4-chlorobenzoyl)-6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1noc2nc(-c3ccco3)cc(C(=O)NNC(=O)c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H13ClN4O4/c1-10-16-13(9-14(15-3-2-8-27-15)21-19(16)28-24-10)18(26)23-22-17(25)11-4-6-12(20)7-5-11/h2-9H,1H3,(H,22,25)(H,23,26) |
| InChIKey | MQKJUUZHVLIRDI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|