About lithium;dibutyl hydrogen phosphate;hydride
lithium;dibutyl hydrogen phosphate;hydride (PubChem CID 174759631) has the molecular formula C8H20LiO4P
and a molecular weight of 218.16 g/mol. Its IUPAC name is lithium;dibutyl hydrogen phosphate;hydride.
Molecular Properties
| Compound Name | lithium;dibutyl hydrogen phosphate;hydride |
| PubChem CID | 174759631 |
| Molecular Formula | C8H20LiO4P |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | lithium;dibutyl hydrogen phosphate;hydride |
| SMILES | CCCCOP(=O)(O)OCCCC.[H-].[Li+] |
| InChI | InChI=1S/C8H19O4P.Li.H/c1-3-5-7-11-13(9,10)12-8-6-4-2;;/h3-8H2,1-2H3,(H,9,10);;/q;+1;-1 |
| InChIKey | XMDZUXVIMFOBPZ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;dibutyl hydrogen phosphate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;dibutyl hydrogen phosphate;hydride?
The IUPAC name of lithium;dibutyl hydrogen phosphate;hydride (CID 174759631) is lithium;dibutyl hydrogen phosphate;hydride.
What is the SMILES notation for lithium;dibutyl hydrogen phosphate;hydride?
The canonical SMILES for lithium;dibutyl hydrogen phosphate;hydride is CCCCOP(=O)(O)OCCCC.[H-].[Li+].
What is the InChIKey of lithium;dibutyl hydrogen phosphate;hydride?
The InChIKey is XMDZUXVIMFOBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O4P.Li.H/c1-3-5-7-11-13(9,10)12-8-6-4-2;;/h3-8H2,1-2H3,(H,9,10);;/q;+1;-1.
What are the key properties of lithium;dibutyl hydrogen phosphate;hydride?
lithium;dibutyl hydrogen phosphate;hydride has a molecular weight of 218.16 g/mol, XLogP of -0.16, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;dibutyl hydrogen phosphate;hydride is sourced from PubChem (CID 174759631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).