About 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one
4-(2-aminoethoxy)-2,5-dimethylfuran-3-one (PubChem CID 174760439) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one |
| PubChem CID | 174760439 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one |
| SMILES | CC1=C(OCCN)C(=O)C(C)O1 |
| InChI | InChI=1S/C8H13NO3/c1-5-7(10)8(6(2)12-5)11-4-3-9/h5H,3-4,9H2,1-2H3 |
| InChIKey | GQYAXOPIIRWMME-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one?
The IUPAC name of 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one (CID 174760439) is 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one.
What is the SMILES notation for 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one?
The canonical SMILES for 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one is CC1=C(OCCN)C(=O)C(C)O1.
What is the InChIKey of 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one?
The InChIKey is GQYAXOPIIRWMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-5-7(10)8(6(2)12-5)11-4-3-9/h5H,3-4,9H2,1-2H3.
What are the key properties of 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one?
4-(2-aminoethoxy)-2,5-dimethylfuran-3-one has a molecular weight of 171.20 g/mol, XLogP of 0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethoxy)-2,5-dimethylfuran-3-one is sourced from PubChem (CID 174760439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).