C40H64N2O4 — CID 174760671
6,6-diamino-7-butyl-4,9-bis(5-tert-butyl-2-hydroxyphenyl)-2,2,11,11-tetramethyldodecane-5,8-dione (PubChem CID 174760671) has the molecular formula C40H64N2O4 and a molecular weight of 636.96 g/mol. Its IUPAC name is 6,6-diamino-7-butyl-4,9-bis(5-tert-butyl-2-hydroxyphenyl)-2,2,11,11-tetramethyldodecane-5,8-dione.
| Compound Name | 6,6-diamino-7-butyl-4,9-bis(5-tert-butyl-2-hydroxyphenyl)-2,2,11,11-tetramethyldodecane-5,8-dione |
|---|---|
| PubChem CID | 174760671 |
| Molecular Formula | C40H64N2O4 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.49 |
| IUPAC Name | 6,6-diamino-7-butyl-4,9-bis(5-tert-butyl-2-hydroxyphenyl)-2,2,11,11-tetramethyldodecane-5,8-dione |
| SMILES | CCCCC(C(=O)C(CC(C)(C)C)c1cc(C(C)(C)C)ccc1O)C(N)(N)C(=O)C(CC(C)(C)C)c1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C40H64N2O4/c1-14-15-16-31(34(45)29(23-36(2,3)4)27-21-25(38(8,9)10)17-19-32(27)43)40(41,42)35(46)30(24-37(5,6)7)28-22-26(39(11,12)13)18-20-33(28)44/h17-22,29-31,43-44H,14-16,23-24,41-42H2,1-13H3 |
| InChIKey | HSFSHOHHTVRJHS-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|