About 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol
2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol (PubChem CID 174760801) has the molecular formula C23H17N5O2
and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol.
Molecular Properties
| Compound Name | 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol |
| PubChem CID | 174760801 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol |
| SMILES | [H]/N=N/c1ccc(-c2cn(-c3ccc4c(O)c5ccccc5c(O)c4c3C)nn2)cc1 |
| InChI | InChI=1S/C23H17N5O2/c1-13-20(28-12-19(26-27-28)14-6-8-15(25-24)9-7-14)11-10-18-21(13)23(30)17-5-3-2-4-16(17)22(18)29/h2-12,24,29-30H,1H3/b25-24+ |
| InChIKey | BSQTZRORVMFUKR-OCOZRVBESA-N |
| XLogP | 5.62 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol?
The IUPAC name of 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol (CID 174760801) is 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol.
What is the SMILES notation for 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol?
The canonical SMILES for 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol is [H]/N=N/c1ccc(-c2cn(-c3ccc4c(O)c5ccccc5c(O)c4c3C)nn2)cc1.
What is the InChIKey of 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol?
The InChIKey is BSQTZRORVMFUKR-OCOZRVBESA-N. The full InChI is InChI=1S/C23H17N5O2/c1-13-20(28-12-19(26-27-28)14-6-8-15(25-24)9-7-14)11-10-18-21(13)23(30)17-5-3-2-4-16(17)22(18)29/h2-12,24,29-30H,1H3/b25-24+.
What are the key properties of 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol?
2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol has a molecular weight of 395.42 g/mol, XLogP of 5.62, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-diazenylphenyl)triazol-1-yl]-1-methylanthracene-9,10-diol is sourced from PubChem (CID 174760801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).