C29H29N5O3 — CID 174761283
[(4R)-4-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-2-yl] 2,2-dimethylpropanoate (PubChem CID 174761283) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is [(4R)-4-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4R)-4-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174761283 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [(4R)-4-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-2-yl] 2,2-dimethylpropanoate |
| SMILES | C#Cc1c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc2n1[C@H]1CNC(OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C29H29N5O3/c1-5-22-24(18-11-13-21(14-12-18)36-20-9-7-6-8-10-20)25-26(30)32-17-33-27(25)34(22)19-15-23(31-16-19)37-28(35)29(2,3)4/h1,6-14,17,19,23,31H,15-16H2,2-4H3,(H2,30,32,33)/t19-,23?/m1/s1 |
| InChIKey | NTJHHPXMDCONHD-HWYAHNCWSA-N |
| XLogP | 4.90 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|