About N-cyanoacetamide;ethyl carbamate
N-cyanoacetamide;ethyl carbamate (PubChem CID 174761407) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is N-cyanoacetamide;ethyl carbamate.
Molecular Properties
| Compound Name | N-cyanoacetamide;ethyl carbamate |
| PubChem CID | 174761407 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N-cyanoacetamide;ethyl carbamate |
| SMILES | CC(=O)NC#N.CCOC(N)=O |
| InChI | InChI=1S/C3H4N2O.C3H7NO2/c1-3(6)5-2-4;1-2-6-3(4)5/h1H3,(H,5,6);2H2,1H3,(H2,4,5) |
| InChIKey | VIMBCHMYWIVPSB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyanoacetamide;ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyanoacetamide;ethyl carbamate?
The IUPAC name of N-cyanoacetamide;ethyl carbamate (CID 174761407) is N-cyanoacetamide;ethyl carbamate.
What is the SMILES notation for N-cyanoacetamide;ethyl carbamate?
The canonical SMILES for N-cyanoacetamide;ethyl carbamate is CC(=O)NC#N.CCOC(N)=O.
What is the InChIKey of N-cyanoacetamide;ethyl carbamate?
The InChIKey is VIMBCHMYWIVPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O.C3H7NO2/c1-3(6)5-2-4;1-2-6-3(4)5/h1H3,(H,5,6);2H2,1H3,(H2,4,5).
What are the key properties of N-cyanoacetamide;ethyl carbamate?
N-cyanoacetamide;ethyl carbamate has a molecular weight of 173.17 g/mol, XLogP of -0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyanoacetamide;ethyl carbamate is sourced from PubChem (CID 174761407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).