About 1H-phenalen-1-yl 5,5-dimethylhexanoate
1H-phenalen-1-yl 5,5-dimethylhexanoate (PubChem CID 174761552) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 1H-phenalen-1-yl 5,5-dimethylhexanoate.
Molecular Properties
| Compound Name | 1H-phenalen-1-yl 5,5-dimethylhexanoate |
| PubChem CID | 174761552 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1H-phenalen-1-yl 5,5-dimethylhexanoate |
| SMILES | CC(C)(C)CCCC(=O)OC1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C21H24O2/c1-21(2,3)14-6-11-19(22)23-18-13-12-16-8-4-7-15-9-5-10-17(18)20(15)16/h4-5,7-10,12-13,18H,6,11,14H2,1-3H3 |
| InChIKey | ZRQYONXFYMIPHE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-phenalen-1-yl 5,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenalen-1-yl 5,5-dimethylhexanoate?
The IUPAC name of 1H-phenalen-1-yl 5,5-dimethylhexanoate (CID 174761552) is 1H-phenalen-1-yl 5,5-dimethylhexanoate.
What is the SMILES notation for 1H-phenalen-1-yl 5,5-dimethylhexanoate?
The canonical SMILES for 1H-phenalen-1-yl 5,5-dimethylhexanoate is CC(C)(C)CCCC(=O)OC1C=Cc2cccc3cccc1c23.
What is the InChIKey of 1H-phenalen-1-yl 5,5-dimethylhexanoate?
The InChIKey is ZRQYONXFYMIPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O2/c1-21(2,3)14-6-11-19(22)23-18-13-12-16-8-4-7-15-9-5-10-17(18)20(15)16/h4-5,7-10,12-13,18H,6,11,14H2,1-3H3.
What are the key properties of 1H-phenalen-1-yl 5,5-dimethylhexanoate?
1H-phenalen-1-yl 5,5-dimethylhexanoate has a molecular weight of 308.42 g/mol, XLogP of 5.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenalen-1-yl 5,5-dimethylhexanoate is sourced from PubChem (CID 174761552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).