C16H13F3N4O5 — CID 17476187
N'-(2,3-dihydro-1,4-dioxine-5-carbonyl)-4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carbohydrazide (PubChem CID 17476187) has the molecular formula C16H13F3N4O5 and a molecular weight of 398.30 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-dioxine-5-carbonyl)-4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-dioxine-5-carbonyl)-4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17476187 |
| Molecular Formula | C16H13F3N4O5 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N'-(2,3-dihydro-1,4-dioxine-5-carbonyl)-4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2C(F)(F)F)cc1O)C1=COCCO1 |
| InChI | InChI=1S/C16H13F3N4O5/c17-16(18,19)9-3-1-2-4-10(9)23-7-11(24)13(22-23)15(26)21-20-14(25)12-8-27-5-6-28-12/h1-4,7-8,24H,5-6H2,(H,20,25)(H,21,26) |
| InChIKey | VCSSEVJITORUGG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|