C25H21NO — CID 174762256
8-[3-(aminomethyl)phenyl]-3,6-dihydro-2H-chrysen-5-one (PubChem CID 174762256) has the molecular formula C25H21NO and a molecular weight of 351.45 g/mol. Its IUPAC name is 8-[3-(aminomethyl)phenyl]-3,6-dihydro-2H-chrysen-5-one.
| Compound Name | 8-[3-(aminomethyl)phenyl]-3,6-dihydro-2H-chrysen-5-one |
|---|---|
| PubChem CID | 174762256 |
| Molecular Formula | C25H21NO |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 8-[3-(aminomethyl)phenyl]-3,6-dihydro-2H-chrysen-5-one |
| SMILES | NCc1cccc(-c2ccc3c(c2)CC(=O)c2c-3ccc3c2=CCCC=3)c1 |
| InChI | InChI=1S/C25H21NO/c26-15-16-4-3-6-18(12-16)19-9-10-21-20(13-19)14-24(27)25-22-7-2-1-5-17(22)8-11-23(21)25/h3-13H,1-2,14-15,26H2 |
| InChIKey | ZMFSVBZIROHLHU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |