C28H27N3O6S2 — CID 174762281
[3-[4-hydroxy-1-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperidin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174762281) has the molecular formula C28H27N3O6S2 and a molecular weight of 565.67 g/mol. Its IUPAC name is [3-[4-hydroxy-1-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperidin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [3-[4-hydroxy-1-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperidin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174762281 |
| Molecular Formula | C28H27N3O6S2 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [3-[4-hydroxy-1-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperidin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1)N1CCC(O)(c2cccc(CS(=O)O)c2)CC1 |
| InChI | InChI=1S/C28H27N3O6S2/c32-27(31-16-13-28(33,14-17-31)23-7-1-4-20(18-23)19-38(34)35)22-9-11-24(12-10-22)30-39(36,37)25-8-2-5-21-6-3-15-29-26(21)25/h1-12,15,18,30,33H,13-14,16-17,19H2,(H,34,35) |
| InChIKey | BRVDMHCTIDPDAV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|