C23H34Br2N2O4 — CID 174762604
ethyl 1,3-bis(4-bromobutyl)-2-hydroxy-4-(4-methoxyphenyl)-6-methyl-2,4-dihydropyrimidine-5-carboxylate (PubChem CID 174762604) has the molecular formula C23H34Br2N2O4 and a molecular weight of 562.34 g/mol. Its IUPAC name is ethyl 1,3-bis(4-bromobutyl)-2-hydroxy-4-(4-methoxyphenyl)-6-methyl-2,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 1,3-bis(4-bromobutyl)-2-hydroxy-4-(4-methoxyphenyl)-6-methyl-2,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174762604 |
| Molecular Formula | C23H34Br2N2O4 |
| Molecular Weight | 562.34 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | ethyl 1,3-bis(4-bromobutyl)-2-hydroxy-4-(4-methoxyphenyl)-6-methyl-2,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CCCCBr)C(O)N(CCCCBr)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H34Br2N2O4/c1-4-31-22(28)20-17(2)26(15-7-5-13-24)23(29)27(16-8-6-14-25)21(20)18-9-11-19(30-3)12-10-18/h9-12,21,23,29H,4-8,13-16H2,1-3H3 |
| InChIKey | MCFDQHVOHUJCAU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|