About dodecan-5-yl hydrogen sulfate;zinc
dodecan-5-yl hydrogen sulfate;zinc (PubChem CID 174762801) has the molecular formula C12H26O4SZn
and a molecular weight of 331.79 g/mol. Its IUPAC name is dodecan-5-yl hydrogen sulfate;zinc.
Molecular Properties
| Compound Name | dodecan-5-yl hydrogen sulfate;zinc |
| PubChem CID | 174762801 |
| Molecular Formula | C12H26O4SZn |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | dodecan-5-yl hydrogen sulfate;zinc |
| SMILES | CCCCCCCC(CCCC)OS(=O)(=O)O.[Zn] |
| InChI | InChI=1S/C12H26O4S.Zn/c1-3-5-7-8-9-11-12(10-6-4-2)16-17(13,14)15;/h12H,3-11H2,1-2H3,(H,13,14,15); |
| InChIKey | BJXBJVCGGGUALO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dodecan-5-yl hydrogen sulfate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-5-yl hydrogen sulfate;zinc?
The IUPAC name of dodecan-5-yl hydrogen sulfate;zinc (CID 174762801) is dodecan-5-yl hydrogen sulfate;zinc.
What is the SMILES notation for dodecan-5-yl hydrogen sulfate;zinc?
The canonical SMILES for dodecan-5-yl hydrogen sulfate;zinc is CCCCCCCC(CCCC)OS(=O)(=O)O.[Zn].
What is the InChIKey of dodecan-5-yl hydrogen sulfate;zinc?
The InChIKey is BJXBJVCGGGUALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4S.Zn/c1-3-5-7-8-9-11-12(10-6-4-2)16-17(13,14)15;/h12H,3-11H2,1-2H3,(H,13,14,15);.
What are the key properties of dodecan-5-yl hydrogen sulfate;zinc?
dodecan-5-yl hydrogen sulfate;zinc has a molecular weight of 331.79 g/mol, XLogP of 3.72, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-5-yl hydrogen sulfate;zinc is sourced from PubChem (CID 174762801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).