About butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite
butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite (PubChem CID 174762814) has the molecular formula C19H26O4S
and a molecular weight of 350.48 g/mol. Its IUPAC name is butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite.
Molecular Properties
| Compound Name | butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite |
| PubChem CID | 174762814 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite |
| SMILES | CCCCOS(=O)OC#CCC1(Oc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H26O4S/c1-2-3-16-21-24(20)22-17-10-15-19(13-8-5-9-14-19)23-18-11-6-4-7-12-18/h4,6-7,11-12H,2-3,5,8-9,13-16H2,1H3 |
| InChIKey | YTQFYZXZWGOQCK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite?
The IUPAC name of butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite (CID 174762814) is butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite.
What is the SMILES notation for butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite?
The canonical SMILES for butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite is CCCCOS(=O)OC#CCC1(Oc2ccccc2)CCCCC1.
What is the InChIKey of butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite?
The InChIKey is YTQFYZXZWGOQCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4S/c1-2-3-16-21-24(20)22-17-10-15-19(13-8-5-9-14-19)23-18-11-6-4-7-12-18/h4,6-7,11-12H,2-3,5,8-9,13-16H2,1H3.
What are the key properties of butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite?
butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite has a molecular weight of 350.48 g/mol, XLogP of 4.53, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-(1-phenoxycyclohexyl)prop-1-ynyl sulfite is sourced from PubChem (CID 174762814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).