About magnesium;hydride;2-oxopropanedioic acid
magnesium;hydride;2-oxopropanedioic acid (PubChem CID 174763054) has the molecular formula C3H4MgO5
and a molecular weight of 144.37 g/mol. Its IUPAC name is magnesium;hydride;2-oxopropanedioic acid.
Molecular Properties
| Compound Name | magnesium;hydride;2-oxopropanedioic acid |
| PubChem CID | 174763054 |
| Molecular Formula | C3H4MgO5 |
| Molecular Weight | 144.37 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | magnesium;hydride;2-oxopropanedioic acid |
| SMILES | O=C(O)C(=O)C(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C3H2O5.Mg.2H/c4-1(2(5)6)3(7)8;;;/h(H,5,6)(H,7,8);;;/q;+2;2*-1 |
| InChIKey | PWVCLHNNWCULGA-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.37 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;2-oxopropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;2-oxopropanedioic acid?
The IUPAC name of magnesium;hydride;2-oxopropanedioic acid (CID 174763054) is magnesium;hydride;2-oxopropanedioic acid.
What is the SMILES notation for magnesium;hydride;2-oxopropanedioic acid?
The canonical SMILES for magnesium;hydride;2-oxopropanedioic acid is O=C(O)C(=O)C(=O)O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;2-oxopropanedioic acid?
The InChIKey is PWVCLHNNWCULGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2O5.Mg.2H/c4-1(2(5)6)3(7)8;;;/h(H,5,6)(H,7,8);;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;2-oxopropanedioic acid?
magnesium;hydride;2-oxopropanedioic acid has a molecular weight of 144.37 g/mol, XLogP of -1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;2-oxopropanedioic acid is sourced from PubChem (CID 174763054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).