3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate

C16H27NO3 — CID 174764189

IUPAC3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate
SMILESC=CCC1(CC=C)CCCNC1=O.CC(C)(C)OC=O
InChIInChI=1S/C11H17NO.C5H10O2/c1-3-6-11(7-4-2)8-5-9-12-10(11)13;1-5(2,3)7-4-6/h3-4H,1-2,5-9H2,(H,12,13);4H,1-3H3
InChIKeyVDHVAXYXJXLNIU-UHFFFAOYSA-N
MW281.40 g/mol
LogP2.99
Rot. Bonds5

About 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate

3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate (PubChem CID 174764189) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate.

Molecular Properties

Compound Name3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate
PubChem CID174764189
Molecular FormulaC16H27NO3
Molecular Weight281.40 g/mol
Exact Mass281.20
IUPAC Name3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate
SMILESC=CCC1(CC=C)CCCNC1=O.CC(C)(C)OC=O
InChIInChI=1S/C11H17NO.C5H10O2/c1-3-6-11(7-4-2)8-5-9-12-10(11)13;1-5(2,3)7-4-6/h3-4H,1-2,5-9H2,(H,12,13);4H,1-3H3
InChIKeyVDHVAXYXJXLNIU-UHFFFAOYSA-N
XLogP2.99
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.40
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate?
The IUPAC name of 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate (CID 174764189) is 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate.
What is the SMILES notation for 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate?
The canonical SMILES for 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate is C=CCC1(CC=C)CCCNC1=O.CC(C)(C)OC=O.
What is the InChIKey of 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate?
The InChIKey is VDHVAXYXJXLNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO.C5H10O2/c1-3-6-11(7-4-2)8-5-9-12-10(11)13;1-5(2,3)7-4-6/h3-4H,1-2,5-9H2,(H,12,13);4H,1-3H3.
What are the key properties of 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate?
3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate has a molecular weight of 281.40 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(prop-2-enyl)piperidin-2-one;tert-butyl formate is sourced from PubChem (CID 174764189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).