C22H26OSi — CID 174764205
6,6-bis(ethenyl)-5,5-dimethyl-2,2-diphenyloxasilinane (PubChem CID 174764205) has the molecular formula C22H26OSi and a molecular weight of 334.54 g/mol. Its IUPAC name is 6,6-bis(ethenyl)-5,5-dimethyl-2,2-diphenyloxasilinane.
| Compound Name | 6,6-bis(ethenyl)-5,5-dimethyl-2,2-diphenyloxasilinane |
|---|---|
| PubChem CID | 174764205 |
| Molecular Formula | C22H26OSi |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 6,6-bis(ethenyl)-5,5-dimethyl-2,2-diphenyloxasilinane |
| SMILES | C=CC1(C=C)O[Si](c2ccccc2)(c2ccccc2)CCC1(C)C |
| InChI | InChI=1S/C22H26OSi/c1-5-22(6-2)21(3,4)17-18-24(23-22,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h5-16H,1-2,17-18H2,3-4H3 |
| InChIKey | SYJSKOLJYRMPFT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|